CAS 63277-57-6 is the registry number for Ethyl 8-bromo-1,3,4,5-tetrahydro-2h-pyrido[4,3-b]indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Ethyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate (CAS 63277-57-6) is a chemical compound with the molecular formula C14H15BrN2O2 and a molecular weight of 323.18 g/mol. IUPAC name: ethyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate. InChIKey: MHGMMWXVHWEKHX-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O2 |
|---|---|
| Molecular weight | 323.18 g/mol |
| IUPAC name | ethyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
| InChIKey | MHGMMWXVHWEKHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC2=C(C1)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)