Products 63277-57-6

CAS 63277-57-6 is the registry number for Ethyl 8-bromo-1,3,4,5-tetrahydro-2h-pyrido[4,3-b]indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate (CAS 63277-57-6) is a chemical compound with the molecular formula C14H15BrN2O2 and a molecular weight of 323.18 g/mol. IUPAC name: ethyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate. InChIKey: MHGMMWXVHWEKHX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15BrN2O2
Molecular weight323.18 g/mol
IUPAC nameethyl 8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate
InChIKeyMHGMMWXVHWEKHX-UHFFFAOYSA-N
SMILESCCOC(=O)N1CCC2=C(C1)C3=C(N2)C=CC(=C3)Br

Computed by PubChem (NCBI)