CAS 1414959-06-0 appears in our catalog under these names: (5-Bromo-quinolin-2-yl)-carbamic acid tert-butyl ester, 95%, tert–Butyl (5–bromoquinolin–2–yl)carbamate, (5-Bromo-quinolin-2-yl)-carbamic acid tert-butyl ester, 95%, 95%, TERT-BUTYL (5-BROMOQUINOLIN-2-YL)CARBAMATE, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl N-(5-bromoquinolin-2-yl)carbamate (CAS 1414959-06-0) is a chemical compound with the molecular formula C14H15BrN2O2 and a molecular weight of 323.18 g/mol. IUPAC name: tert-butyl N-(5-bromoquinolin-2-yl)carbamate. InChIKey: FTPCWVKIEPTNRS-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O2 |
|---|---|
| Molecular weight | 323.18 g/mol |
| IUPAC name | tert-butyl N-(5-bromoquinolin-2-yl)carbamate |
| InChIKey | FTPCWVKIEPTNRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C=C1)C(=CC=C2)Br |
Computed by PubChem (NCBI)