CAS 1445322-61-1 is the registry number for Methyl 7-bromo-1-cyclopentyl-1,3-benzodiazole-5-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
Methyl 7-bromo-1-cyclopentylbenzimidazole-5-carboxylate (CAS 1445322-61-1) is a chemical compound with the molecular formula C14H15BrN2O2 and a molecular weight of 323.18 g/mol. IUPAC name: methyl 7-bromo-1-cyclopentylbenzimidazole-5-carboxylate. InChIKey: RZOBDOXWWPSSLH-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O2 |
|---|---|
| Molecular weight | 323.18 g/mol |
| IUPAC name | methyl 7-bromo-1-cyclopentylbenzimidazole-5-carboxylate |
| InChIKey | RZOBDOXWWPSSLH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Br)N(C=N2)C3CCCC3 |
Computed by PubChem (NCBI)