Products 1100598-49-9
CAS 1100598-49-9 appears in our catalog under these names: 6-(1-Methyl-1h-pyrazol-4-yl)-2,3-dihydropyridazin-3-one, 95%, 6-(1-Methyl-1H-pyrazol-4-yl)-2,3-dihydropyridazin-3-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
3-(1-methylpyrazol-4-yl)-1H-pyridazin-6-one (CAS 1100598-49-9) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-1H-pyridazin-6-one. InChIKey: RRXNTXQNCPCZIZ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)-1H-pyridazin-6-one |
| InChIKey | RRXNTXQNCPCZIZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NNC(=O)C=C2 |
Computed by PubChem (NCBI)