CAS 39225-60-0 appears in our catalog under these names: 4,5,6,7-tetrahydro-8h-cyclopenta[d][1,2,4]triazolo[1,5-a]pyrimidin-8-one, 95%, 1,8,10,12-Tetraazatricyclo(7.3.0.0,3,7)dodeca-3(7),9,11-trien-2-one, 95%, 1,8,10,12-Tetraazatricyclo(7.3.0.0,3,7)dodeca-3(7),9,11-trien-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g, 50mg.
1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (CAS 39225-60-0) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one. InChIKey: FXFOMFKXWFKHML-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| InChIKey | FXFOMFKXWFKHML-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N=C3N=CNN3C2=O |
Computed by PubChem (NCBI)