CAS 110073-78-4 is the registry number for Methyl 1-tosyl-1h-indole-5-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 1-(4-methylphenyl)sulfonylindole-5-carboxylate (CAS 110073-78-4) is a chemical compound with the molecular formula C17H15NO4S and a molecular weight of 329.4 g/mol. IUPAC name: methyl 1-(4-methylphenyl)sulfonylindole-5-carboxylate. InChIKey: RNSIMXRFOSKPFN-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | methyl 1-(4-methylphenyl)sulfonylindole-5-carboxylate |
| InChIKey | RNSIMXRFOSKPFN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=CC(=C3)C(=O)OC |
Computed by PubChem (NCBI)