Products 2493426-61-0
CAS 2493426-61-0 is the registry number for 3-((3,5-Dimethylphenyl)sulfonyl)-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-dimethylphenyl)sulfonyl-1H-indole-2-carboxylic acid (CAS 2493426-61-0) is a chemical compound with the molecular formula C17H15NO4S and a molecular weight of 329.4 g/mol. IUPAC name: 3-(3,5-dimethylphenyl)sulfonyl-1H-indole-2-carboxylic acid. InChIKey: LRBMTSWHVUZMFY-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 3-(3,5-dimethylphenyl)sulfonyl-1H-indole-2-carboxylic acid |
| InChIKey | LRBMTSWHVUZMFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)S(=O)(=O)C2=C(NC3=CC=CC=C32)C(=O)O)C |
Computed by PubChem (NCBI)