CAS 379729-42-7 is the registry number for 3-[4-(2,3-Dihydro-indole-1-sulfonyl)-phenyl]-acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoic acid (CAS 379729-42-7) is a chemical compound with the molecular formula C17H15NO4S and a molecular weight of 329.4 g/mol. IUPAC name: (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoic acid. InChIKey: KFACIPILBRUIND-JXMROGBWSA-N.
| Molecular formula | C17H15NO4S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoic acid |
| InChIKey | KFACIPILBRUIND-JXMROGBWSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)C3=CC=C(C=C3)/C=C/C(=O)O |
Computed by PubChem (NCBI)