Products 379729-42-7

CAS 379729-42-7 is the registry number for 3-[4-(2,3-Dihydro-indole-1-sulfonyl)-phenyl]-acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoic acid (CAS 379729-42-7) is a chemical compound with the molecular formula C17H15NO4S and a molecular weight of 329.4 g/mol. IUPAC name: (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoic acid. InChIKey: KFACIPILBRUIND-JXMROGBWSA-N.

Identity
Molecular formulaC17H15NO4S
Molecular weight329.4 g/mol
IUPAC name(E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoic acid
InChIKeyKFACIPILBRUIND-JXMROGBWSA-N
SMILESC1CN(C2=CC=CC=C21)S(=O)(=O)C3=CC=C(C=C3)/C=C/C(=O)O

Computed by PubChem (NCBI)