CAS 1325307-50-3 is the registry number for Methyl 4-(4-methylphenyl)-4h-1,4-benzothiazine-2-carboxylate 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-(4-methylphenyl)-1,1-dioxo-1lambda6,4-benzothiazine-2-carboxylate (CAS 1325307-50-3) is a chemical compound with the molecular formula C17H15NO4S and a molecular weight of 329.4 g/mol. IUPAC name: methyl 4-(4-methylphenyl)-1,1-dioxo-1lambda6,4-benzothiazine-2-carboxylate. InChIKey: PRKAMJHQKDLXJZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | methyl 4-(4-methylphenyl)-1,1-dioxo-1lambda6,4-benzothiazine-2-carboxylate |
| InChIKey | PRKAMJHQKDLXJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C=C(S(=O)(=O)C3=CC=CC=C32)C(=O)OC |
Computed by PubChem (NCBI)