Products 110074-87-8

CAS 110074-87-8 is the registry number for 1-AMino-7-boc-7-azaspiro(3.5)nonane hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride (CAS 110074-87-8) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride. InChIKey: GLRKHHOEBIYDPM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H25ClN2O2
Molecular weight276.80 g/mol
IUPAC nametert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate;hydrochloride
InChIKeyGLRKHHOEBIYDPM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCC2N)CC1.Cl

Computed by PubChem (NCBI)