Products 1101120-11-9
CAS 1101120-11-9 is the registry number for 3-Formylpyrazolo(1,5-a)pyridine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-formylpyrazolo[1,5-a]pyridine-5-carboxylic acid (CAS 1101120-11-9) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-formylpyrazolo[1,5-a]pyridine-5-carboxylic acid. InChIKey: HLAIFYPVBLQHGX-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-formylpyrazolo[1,5-a]pyridine-5-carboxylic acid |
| InChIKey | HLAIFYPVBLQHGX-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C=O)C=C1C(=O)O |
Computed by PubChem (NCBI)