CAS 110117-84-5 appears in our catalog under these names: H–D–Phe(3–F)–OH, H-D-Phe(3-F)-OH, 3-Fluoro-D-phenylalanine, 95% , 3-Fluoro-D-Phenylalanine, 97%, 97%, H-D-Phe(3-F)-OH, 99.85%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress. Available pack sizes: 1g, 500mg, 5g, 25g, 10g, 100g, 100 g, 5 g.
(2R)-2-amino-3-(3-fluorophenyl)propanoic acid (CAS 110117-84-5) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: (2R)-2-amino-3-(3-fluorophenyl)propanoic acid. InChIKey: VWHRYODZTDMVSS-MRVPVSSYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-fluorophenyl)propanoic acid |
| InChIKey | VWHRYODZTDMVSS-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)