Products 456-88-2
CAS 456-88-2 appears in our catalog under these names: 2-Amino-3-(3-fluorophenyl)propanoic acid, 98%, H–m–Fluoro–DL–Phe–OH, 3-Fluoro-DL-phenylalanine, >98.0%(HPLC)(T), H-DL-Phe(3-F)-OH, 95%, 95%, H-DL-Phe(3-F)-OH, 98.0%. Offered by: Fluorochem, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 25 g, 100 g.
2-amino-3-(3-fluorophenyl)propanoic acid (CAS 456-88-2) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 2-amino-3-(3-fluorophenyl)propanoic acid. InChIKey: VWHRYODZTDMVSS-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 2-amino-3-(3-fluorophenyl)propanoic acid |
| InChIKey | VWHRYODZTDMVSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)