CAS 110179-22-1 is the registry number for 1-Benzyl-1H-benzo[d]imidazol-2-amine hydrochloride, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-benzylbenzimidazol-2-amine;hydrochloride (CAS 110179-22-1) is a chemical compound with the molecular formula C14H14ClN3 and a molecular weight of 259.73 g/mol. IUPAC name: 1-benzylbenzimidazol-2-amine;hydrochloride. InChIKey: QBEIIUWOQPFCHM-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 1-benzylbenzimidazol-2-amine;hydrochloride |
| InChIKey | QBEIIUWOQPFCHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=C2N.Cl |
Computed by PubChem (NCBI)