Products 1101927-73-4
CAS 1101927-73-4 is the registry number for 1-(tert-Butyl) 2-methyl (2S,3S)-3-methylpyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-methyl (2S,3S)-3-methylpyrrolidine-1,2-dicarboxylate (CAS 1101927-73-4) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,3S)-3-methylpyrrolidine-1,2-dicarboxylate. InChIKey: WONWFUGZCJWLGL-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,3S)-3-methylpyrrolidine-1,2-dicarboxylate |
| InChIKey | WONWFUGZCJWLGL-IUCAKERBSA-N |
| SMILES | C[C@H]1CCN([C@@H]1C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)