Products 1803566-94-0

CAS 1803566-94-0 is the registry number for 1-tert-Butyl 2-methyl 3-methylpyrrolidine-1,2-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.

1-O-tert-butyl 2-O-methyl 3-methylpyrrolidine-1,2-dicarboxylate (CAS 1803566-94-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 3-methylpyrrolidine-1,2-dicarboxylate. InChIKey: WONWFUGZCJWLGL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 3-methylpyrrolidine-1,2-dicarboxylate
InChIKeyWONWFUGZCJWLGL-UHFFFAOYSA-N
SMILESCC1CCN(C1C(=O)OC)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)