Products 110196-91-3
CAS 110196-91-3 is the registry number for N-[3-(2-Oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide (CAS 110196-91-3) is a chemical compound with the molecular formula C12H11N3O2S and a molecular weight of 261.30 g/mol. IUPAC name: N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide. InChIKey: DLMNQQBXDYRYHX-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide |
| InChIKey | DLMNQQBXDYRYHX-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=NSC(=N1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)