CAS 1707737-24-3 is the registry number for 4-Phenyl-3,4-dihydro-2h-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-phenyl-2,3-dihydropyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide (CAS 1707737-24-3) is a chemical compound with the molecular formula C12H11N3O2S and a molecular weight of 261.30 g/mol. IUPAC name: 4-phenyl-2,3-dihydropyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide. InChIKey: PBQDHMRAVYMVRA-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 4-phenyl-2,3-dihydropyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide |
| InChIKey | PBQDHMRAVYMVRA-UHFFFAOYSA-N |
| SMILES | C1NS(=O)(=O)C2=C(N1C3=CC=CC=C3)N=CC=C2 |
Computed by PubChem (NCBI)