Products 1707737-24-3

CAS 1707737-24-3 is the registry number for 4-Phenyl-3,4-dihydro-2h-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-phenyl-2,3-dihydropyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide (CAS 1707737-24-3) is a chemical compound with the molecular formula C12H11N3O2S and a molecular weight of 261.30 g/mol. IUPAC name: 4-phenyl-2,3-dihydropyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide. InChIKey: PBQDHMRAVYMVRA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O2S
Molecular weight261.30 g/mol
IUPAC name4-phenyl-2,3-dihydropyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide
InChIKeyPBQDHMRAVYMVRA-UHFFFAOYSA-N
SMILESC1NS(=O)(=O)C2=C(N1C3=CC=CC=C3)N=CC=C2

Computed by PubChem (NCBI)