CAS 5898-41-9 appears in our catalog under these names: Allyl-[4-(4-nitro-phenyl)-thiazol-2-yl]-amine, 95%, (4-(4-nitrophenyl)(2,5-thiazolyl))prop-2-enylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2g.
4-(4-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-amine (CAS 5898-41-9) is a chemical compound with the molecular formula C12H11N3O2S and a molecular weight of 261.30 g/mol. IUPAC name: 4-(4-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-amine. InChIKey: RTEQUIPYSDUEKA-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-N-prop-2-enyl-1,3-thiazol-2-amine |
| InChIKey | RTEQUIPYSDUEKA-UHFFFAOYSA-N |
| SMILES | C=CCNC1=NC(=CS1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)