Products 1239764-78-3
CAS 1239764-78-3 is the registry number for 1-(1,3-Benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxamide (CAS 1239764-78-3) is a chemical compound with the molecular formula C12H11N3O2S and a molecular weight of 261.30 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxamide. InChIKey: QCGMGFRDGBZZDG-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxamide |
| InChIKey | QCGMGFRDGBZZDG-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=NC3=CC=CC=C3S2)C(=O)N |
Computed by PubChem (NCBI)