CAS 110221-04-0 appears in our catalog under these names: (R)-2-Amino-3-(4-fluoro-1h-indol-3-yl)propanoic acid, 95%, H-D-Trp(4-F)-OH 95+%, (R)-2-Amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid, 95+%, 95+%, (R)-2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg.
(2R)-2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid (CAS 110221-04-0) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: (2R)-2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: DEBQMEYEKKWIKC-MRVPVSSYSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | DEBQMEYEKKWIKC-MRVPVSSYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=CN2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)