Products 1102373-38-5

CAS 1102373-38-5 appears in our catalog under these names: 3-(2,4,6-Trifluoro-phenyl)-propionic acid, 95%, 3-(2,4,6-Trifluoro-phenyl)-propionic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(2,4,6-trifluorophenyl)propanoic acid (CAS 1102373-38-5) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 3-(2,4,6-trifluorophenyl)propanoic acid. InChIKey: GXHOHDFSURPGPL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O2
Molecular weight204.15 g/mol
IUPAC name3-(2,4,6-trifluorophenyl)propanoic acid
InChIKeyGXHOHDFSURPGPL-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)CCC(=O)O)F)F

Computed by PubChem (NCBI)