CAS 110270-70-7 is the registry number for HW 173. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aR,10bR)-4-benzyl-9-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline (CAS 110270-70-7) is a chemical compound with the molecular formula C21H25NO and a molecular weight of 307.4 g/mol. IUPAC name: (4aR,10bR)-4-benzyl-9-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline. InChIKey: NSGMNJDNHSTYBY-TZIWHRDSSA-N.
| Molecular formula | C21H25NO |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (4aR,10bR)-4-benzyl-9-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline |
| InChIKey | NSGMNJDNHSTYBY-TZIWHRDSSA-N |
| SMILES | COC1=CC2=C(CC[C@@H]3[C@@H]2CCCN3CC4=CC=CC=C4)C=C1 |
Computed by PubChem (NCBI)