CAS 110311-45-0 appears in our catalog under these names: (2R)-2-(4-Fluorophenyl)-3-methylbutanoic acid, 95%, (R)–2–(4–Fluorophenyl)–3–methylbutanoic acid, (R)-2-(4-Fluorophenyl)-3-methylbutanoic acid 98%, (R)-2-(4-Fluorophenyl)-3-methylbutanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg, 5g.
(2R)-2-(4-fluorophenyl)-3-methylbutanoic acid (CAS 110311-45-0) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: (2R)-2-(4-fluorophenyl)-3-methylbutanoic acid. InChIKey: YBQLHBYGMUXCEW-SNVBAGLBSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | (2R)-2-(4-fluorophenyl)-3-methylbutanoic acid |
| InChIKey | YBQLHBYGMUXCEW-SNVBAGLBSA-N |
| SMILES | CC(C)[C@H](C1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)