CAS 55332-37-1 appears in our catalog under these names: (S)–2–(4–Fluorophenyl)–3–methylbutanoic acid, (S)-2-(4-Fluorophenyl)-3-methylbutanoic acid 98%, (S)-2-(4-Fluorophenyl)-3-methylbutanoic acid, 98%, 98%, (S)-2-(4-Fluorophenyl)-3-methylbutanoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(4-fluorophenyl)-3-methylbutanoic acid (CAS 55332-37-1) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: (2S)-2-(4-fluorophenyl)-3-methylbutanoic acid. InChIKey: YBQLHBYGMUXCEW-JTQLQIEISA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | (2S)-2-(4-fluorophenyl)-3-methylbutanoic acid |
| InChIKey | YBQLHBYGMUXCEW-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)