CAS 1104011-35-9 appears in our catalog under these names: ((R)-1-((S)-3-Phenyl-2-(pyrazine-2-carboxamido)propanamido)pentyl)boronic acid, 98%, Bortezomib Impurity 59, Bortezomib Impurity 64, Desisobutyl-n-butyl Bortezomib. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 5mg.
[(1R)-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]pentyl]boronic acid (CAS 1104011-35-9) is a chemical compound with the molecular formula C19H25BN4O4 and a molecular weight of 384.2 g/mol. IUPAC name: [(1R)-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]pentyl]boronic acid. InChIKey: MDGKEQJOTKHQBX-RDJZCZTQSA-N.
| Molecular formula | C19H25BN4O4 |
|---|---|
| Molecular weight | 384.2 g/mol |
| IUPAC name | [(1R)-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]pentyl]boronic acid |
| InChIKey | MDGKEQJOTKHQBX-RDJZCZTQSA-N |
| SMILES | B([C@H](CCCC)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O |
Computed by PubChem (NCBI)