CAS 1132709-16-0 appears in our catalog under these names: ((S)-3-Methyl-1-((R)-3-phenyl-2-(pyrazine-2-carboxamido)propanamido)butyl)boronic acid, 98+%, (1S,2R)-Bortezomib, Bortezomib Impurity 8. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[(1S)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (CAS 1132709-16-0) is a chemical compound with the molecular formula C19H25BN4O4 and a molecular weight of 384.2 g/mol. IUPAC name: [(1S)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid. InChIKey: GXJABQQUPOEUTA-NVXWUHKLSA-N.
| Molecular formula | C19H25BN4O4 |
|---|---|
| Molecular weight | 384.2 g/mol |
| IUPAC name | [(1S)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| InChIKey | GXJABQQUPOEUTA-NVXWUHKLSA-N |
| SMILES | B([C@@H](CC(C)C)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O |
Computed by PubChem (NCBI)