CAS 1132709-15-9 appears in our catalog under these names: (1R,2R)-Bortezomib, (1R,2R)-Bortezomib 98+%. Offered by: Chemat Brand, TRC, Ambeed. Available pack sizes: on request, 50mg, 5mg, 100mg, 250mg, 1g.
[(1R)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (CAS 1132709-15-9) is a chemical compound with the molecular formula C19H25BN4O4 and a molecular weight of 384.2 g/mol. IUPAC name: [(1R)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid. InChIKey: GXJABQQUPOEUTA-WBVHZDCISA-N.
| Molecular formula | C19H25BN4O4 |
|---|---|
| Molecular weight | 384.2 g/mol |
| IUPAC name | [(1R)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| InChIKey | GXJABQQUPOEUTA-WBVHZDCISA-N |
| SMILES | B([C@H](CC(C)C)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O |
Computed by PubChem (NCBI)