CAS 1132709-14-8 appears in our catalog under these names: Bortezomib Impurity PS619, (1S,2S)-Bortezomib, (1S,2S)–Bortezomib, (1S,2S)-Bortezomib/ 98.33% (existing batch purity), (1S,2S)-Bortezomib 98%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 25mg, 50mg, 100mg.
[(1S)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (CAS 1132709-14-8) is a chemical compound with the molecular formula C19H25BN4O4 and a molecular weight of 384.2 g/mol. IUPAC name: [(1S)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid. InChIKey: GXJABQQUPOEUTA-DOTOQJQBSA-N.
| Molecular formula | C19H25BN4O4 |
|---|---|
| Molecular weight | 384.2 g/mol |
| IUPAC name | [(1S)-3-methyl-1-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| InChIKey | GXJABQQUPOEUTA-DOTOQJQBSA-N |
| SMILES | B([C@@H](CC(C)C)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O |
Computed by PubChem (NCBI)