Products 1104225-58-2
CAS 1104225-58-2 appears in our catalog under these names: 2-(3-(4-Methoxyphenyl)prop-2-enamido)-3-methylbutanoic acid, (2S)-2-(3-(4-Methoxyphenyl)prop-2-enamido)-3-methylbutanoic acid, 95%, 2-([(2E)-3-(4-Methoxyphenyl)prop-2-enoyl]amino)-3-methylbutanoic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg, 100mg.
2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-3-methylbutanoic acid (CAS 1104225-58-2) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-3-methylbutanoic acid. InChIKey: GJNMUKNLXQRDQV-RMKNXTFCSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-3-methylbutanoic acid |
| InChIKey | GJNMUKNLXQRDQV-RMKNXTFCSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)/C=C/C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)