Products 1104383-68-7
CAS 1104383-68-7 appears in our catalog under these names: 2-Methyl-6-(trifluoromethyl)benzoic acid, 95%, 2–Methyl–6–trifluoromethylbenzoic acid, 2-Methyl-6-(trifluoromethyl)benzoic acid, 2-Methyl-6-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-methyl-6-(trifluoromethyl)benzoic acid (CAS 1104383-68-7) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2-methyl-6-(trifluoromethyl)benzoic acid. InChIKey: HNIHCUXXQZGRAU-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2-methyl-6-(trifluoromethyl)benzoic acid |
| InChIKey | HNIHCUXXQZGRAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)