CAS 1104636-71-6 appears in our catalog under these names: 2-(3-Methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 97%, 3–Methoxyphenylboronic acid MIDA ester, 2-(3-Methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 99%(GC-MS),RG, 99%(GC-MS),RG. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
2-(3-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1104636-71-6) is a chemical compound with the molecular formula C12H14BNO5 and a molecular weight of 263.06 g/mol. IUPAC name: 2-(3-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: BIXVKIPQNJRPKQ-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO5 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | BIXVKIPQNJRPKQ-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)