Products 1842397-36-7
CAS 1842397-36-7 appears in our catalog under these names: Ledaborbactam, Ledaborbactam, 99.12%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 25 mg, 10 mg, 5 mg, 50 mg.
(3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (CAS 1842397-36-7) is a chemical compound with the molecular formula C12H14BNO5 and a molecular weight of 263.06 g/mol. IUPAC name: (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid. InChIKey: QAGGLFCWUVSERJ-VIFPVBQESA-N.
| Molecular formula | C12H14BNO5 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| InChIKey | QAGGLFCWUVSERJ-VIFPVBQESA-N |
| SMILES | B1([C@H](CC2=C(O1)C(=CC=C2)C(=O)O)NC(=O)CC)O |
Computed by PubChem (NCBI)