Products 1257739-11-9
CAS 1257739-11-9 is the registry number for 2-(4-Methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257739-11-9) is a chemical compound with the molecular formula C12H14BNO5 and a molecular weight of 263.06 g/mol. IUPAC name: 2-(4-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: UMYGAOMZGXRKKP-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO5 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | UMYGAOMZGXRKKP-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)