CAS 1258238-85-5 appears in our catalog under these names: 2-(4-Methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 97%, 4-Methoxyphenylboronic acid MIDA ester, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 200g.
2-(4-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1258238-85-5) is a chemical compound with the molecular formula C12H14BNO5 and a molecular weight of 263.06 g/mol. IUPAC name: 2-(4-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: UMYGAOMZGXRKKP-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO5 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | UMYGAOMZGXRKKP-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)