Products 110473-56-8
CAS 110473-56-8 is the registry number for Ethyl 3-(4-chloro-3-nitrophenyl)-3-oxopropionate. Offered by: Fluorochem. Available pack sizes: 1g.
Ethyl 3-(4-chloro-3-nitrophenyl)-3-oxopropanoate (CAS 110473-56-8) is a chemical compound with the molecular formula C11H10ClNO5 and a molecular weight of 271.65 g/mol. IUPAC name: ethyl 3-(4-chloro-3-nitrophenyl)-3-oxopropanoate. InChIKey: MKHNWKZPVONWGU-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO5 |
|---|---|
| Molecular weight | 271.65 g/mol |
| IUPAC name | ethyl 3-(4-chloro-3-nitrophenyl)-3-oxopropanoate |
| InChIKey | MKHNWKZPVONWGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)