CAS 85633-96-1 is the registry number for 4-(4-Chloro-3-nitrophenyl)-3-methyl-4-oxobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
4-(4-chloro-3-nitrophenyl)-3-methyl-4-oxobutanoic acid (CAS 85633-96-1) is a chemical compound with the molecular formula C11H10ClNO5 and a molecular weight of 271.65 g/mol. IUPAC name: 4-(4-chloro-3-nitrophenyl)-3-methyl-4-oxobutanoic acid. InChIKey: ZDGKTISONWFCDF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO5 |
|---|---|
| Molecular weight | 271.65 g/mol |
| IUPAC name | 4-(4-chloro-3-nitrophenyl)-3-methyl-4-oxobutanoic acid |
| InChIKey | ZDGKTISONWFCDF-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)C(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)