Products 2677030-69-0
CAS 2677030-69-0 is the registry number for Methyl 4-(2-chloro-6-nitrophenyl)-3-oxobutanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(2-chloro-6-nitrophenyl)-3-oxobutanoate (CAS 2677030-69-0) is a chemical compound with the molecular formula C11H10ClNO5 and a molecular weight of 271.65 g/mol. IUPAC name: methyl 4-(2-chloro-6-nitrophenyl)-3-oxobutanoate. InChIKey: ZRDJPPPPJUJOJO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO5 |
|---|---|
| Molecular weight | 271.65 g/mol |
| IUPAC name | methyl 4-(2-chloro-6-nitrophenyl)-3-oxobutanoate |
| InChIKey | ZRDJPPPPJUJOJO-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)CC1=C(C=CC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)