CAS 923034-23-5 is the registry number for Dimethyl 2-(6-chloronicotinoyl) malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
Dimethyl 2-(6-chloropyridine-3-carbonyl)propanedioate (CAS 923034-23-5) is a chemical compound with the molecular formula C11H10ClNO5 and a molecular weight of 271.65 g/mol. IUPAC name: dimethyl 2-(6-chloropyridine-3-carbonyl)propanedioate. InChIKey: QYOPTGFIERTTST-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO5 |
|---|---|
| Molecular weight | 271.65 g/mol |
| IUPAC name | dimethyl 2-(6-chloropyridine-3-carbonyl)propanedioate |
| InChIKey | QYOPTGFIERTTST-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)C1=CN=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)