Products 1105191-82-9
CAS 1105191-82-9 is the registry number for (5-(2,4-Difluorophenyl)-1,2-oxazol-3-yl)methanamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]methanamine (CAS 1105191-82-9) is a chemical compound with the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. IUPAC name: [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]methanamine. InChIKey: YEAOBZWPCOMYAO-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]methanamine |
| InChIKey | YEAOBZWPCOMYAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CC(=NO2)CN |
Computed by PubChem (NCBI)