Products 1105194-56-6
CAS 1105194-56-6 appears in our catalog under these names: 4,5-Dimethyl-2-piperazin-1-yl-1,3-benzothiazole, 95%, 4,5-Dimethyl-2-(piperazin-1-yl)benzo(D)thiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
4,5-dimethyl-2-piperazin-1-yl-1,3-benzothiazole (CAS 1105194-56-6) is a chemical compound with the molecular formula C13H17N3S and a molecular weight of 247.36 g/mol. IUPAC name: 4,5-dimethyl-2-piperazin-1-yl-1,3-benzothiazole. InChIKey: QSOATHAOBLBZEL-UHFFFAOYSA-N.
| Molecular formula | C13H17N3S |
|---|---|
| Molecular weight | 247.36 g/mol |
| IUPAC name | 4,5-dimethyl-2-piperazin-1-yl-1,3-benzothiazole |
| InChIKey | QSOATHAOBLBZEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)SC(=N2)N3CCNCC3)C |
Computed by PubChem (NCBI)