CAS 870693-07-5 is the registry number for 5-((Dimethylamino)methyl)-4-(4-methylphenyl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(dimethylamino)methyl]-4-(4-methylphenyl)-1,3-thiazol-2-amine (CAS 870693-07-5) is a chemical compound with the molecular formula C13H17N3S and a molecular weight of 247.36 g/mol. IUPAC name: 5-[(dimethylamino)methyl]-4-(4-methylphenyl)-1,3-thiazol-2-amine. InChIKey: KWYWXJMTLIFSKE-UHFFFAOYSA-N.
| Molecular formula | C13H17N3S |
|---|---|
| Molecular weight | 247.36 g/mol |
| IUPAC name | 5-[(dimethylamino)methyl]-4-(4-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | KWYWXJMTLIFSKE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(SC(=N2)N)CN(C)C |
Computed by PubChem (NCBI)