CAS 39263-81-5 is the registry number for 2–Phenyl–1,2,4–triaza–spiro(4·5)decane–3–thione. Offered by: GLPBio. Available pack sizes: 1g, 2g.
2-phenyl-1,2,4-triazaspiro[4.5]decane-3-thione (CAS 39263-81-5) is a chemical compound with the molecular formula C13H17N3S and a molecular weight of 247.36 g/mol. IUPAC name: 2-phenyl-1,2,4-triazaspiro[4.5]decane-3-thione. InChIKey: MUADWFSXXPVRAV-UHFFFAOYSA-N.
| Molecular formula | C13H17N3S |
|---|---|
| Molecular weight | 247.36 g/mol |
| IUPAC name | 2-phenyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| InChIKey | MUADWFSXXPVRAV-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)NC(=S)N(N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)