Products 852217-78-8
CAS 852217-78-8 appears in our catalog under these names: 2-Cyano-3-(2,5-dimethyl-1-propyl-1H-pyrrol-3-yl)prop-2-enethioamide, 95%, 2-Cyano-3-(2,5-dimethyl-1-propyl-1H-pyrrol-3-yl)prop-2-enethioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enethioamide (CAS 852217-78-8) is a chemical compound with the molecular formula C13H17N3S and a molecular weight of 247.36 g/mol. IUPAC name: (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enethioamide. InChIKey: UXDWNBDZMMCIHD-KPKJPENVSA-N.
| Molecular formula | C13H17N3S |
|---|---|
| Molecular weight | 247.36 g/mol |
| IUPAC name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enethioamide |
| InChIKey | UXDWNBDZMMCIHD-KPKJPENVSA-N |
| SMILES | CCCN1C(=CC(=C1C)/C=C(\C#N)/C(=S)N)C |
Computed by PubChem (NCBI)