Products 1105662-39-2
CAS 1105662-39-2 is the registry number for 3-Chloro-7,8-dihydroisoquinolin-5(6H)-one, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
3-chloro-7,8-dihydro-6H-isoquinolin-5-one (CAS 1105662-39-2) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 3-chloro-7,8-dihydro-6H-isoquinolin-5-one. InChIKey: JOENMMZAMPPISD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 3-chloro-7,8-dihydro-6H-isoquinolin-5-one |
| InChIKey | JOENMMZAMPPISD-UHFFFAOYSA-N |
| SMILES | C1CC2=CN=C(C=C2C(=O)C1)Cl |
Computed by PubChem (NCBI)