CAS 1106685-85-1 appears in our catalog under these names: 2-((4,6-Dimethylpyrimidin-2-yl)oxy)-3-hydroxy-3,3-diphenylpropanoic acid, 95%, rac O-Demethyl Ambrisentan, AMBRISENTAN RELATED COMPOUND C. Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25MG.
2-(4,6-dimethylpyrimidin-2-yl)oxy-3-hydroxy-3,3-diphenylpropanoic acid (CAS 1106685-85-1) is a chemical compound with the molecular formula C21H20N2O4 and a molecular weight of 364.4 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-hydroxy-3,3-diphenylpropanoic acid. InChIKey: RYOVARHODFXRJC-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O4 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-hydroxy-3,3-diphenylpropanoic acid |
| InChIKey | RYOVARHODFXRJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)OC(C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O)C |
Computed by PubChem (NCBI)