Products 1158945-78-8
CAS 1158945-78-8 is the registry number for Tadalafil Impurity 120. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (CAS 1158945-78-8) is a chemical compound with the molecular formula C21H20N2O4 and a molecular weight of 364.4 g/mol. IUPAC name: ethyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: PVOZBOVBXZLVEO-VQIMIIECSA-N.
| Molecular formula | C21H20N2O4 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | ethyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | PVOZBOVBXZLVEO-VQIMIIECSA-N |
| SMILES | CCOC(=O)[C@H]1CC2=C([C@H](N1)C3=CC4=C(C=C3)OCO4)NC5=CC=CC=C25 |
Computed by PubChem (NCBI)
Synonyms:
Tadalafil Impurity 28