CAS 3068828-64-5 is the registry number for ZGL-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-(1H-indol-3-yl)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoic acid (CAS 3068828-64-5) is a chemical compound with the molecular formula C21H20N2O4 and a molecular weight of 364.4 g/mol. IUPAC name: (2S)-3-(1H-indol-3-yl)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoic acid. InChIKey: BBBZKTUFHIHEPV-BLRBJFNZSA-N.
| Molecular formula | C21H20N2O4 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (2S)-3-(1H-indol-3-yl)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoic acid |
| InChIKey | BBBZKTUFHIHEPV-BLRBJFNZSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)