Products 1451566-78-1
CAS 1451566-78-1 is the registry number for Ethyl (6-methoxy-4-phenylquinoline-2-carbonyl)glycinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(6-methoxy-4-phenylquinoline-2-carbonyl)amino]acetate (CAS 1451566-78-1) is a chemical compound with the molecular formula C21H20N2O4 and a molecular weight of 364.4 g/mol. IUPAC name: ethyl 2-[(6-methoxy-4-phenylquinoline-2-carbonyl)amino]acetate. InChIKey: AYQONPKHMJXCPX-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O4 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | ethyl 2-[(6-methoxy-4-phenylquinoline-2-carbonyl)amino]acetate |
| InChIKey | AYQONPKHMJXCPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C1=NC2=C(C=C(C=C2)OC)C(=C1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)