CAS 110675-64-4 is the registry number for Betaine Isopropyl Ester Chloride. Offered by: Mikromol. Available pack sizes: 25mg.
Trimethyl-(2-oxo-2-propan-2-yloxyethyl)azanium chloride (CAS 110675-64-4) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: trimethyl-(2-oxo-2-propan-2-yloxyethyl)azanium chloride. InChIKey: JAPCBMXNZAHKQY-UHFFFAOYSA-M.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | trimethyl-(2-oxo-2-propan-2-yloxyethyl)azanium chloride |
| InChIKey | JAPCBMXNZAHKQY-UHFFFAOYSA-M |
| SMILES | CC(C)OC(=O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)