Products 110675-64-4

CAS 110675-64-4 is the registry number for Betaine Isopropyl Ester Chloride. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Trimethyl-(2-oxo-2-propan-2-yloxyethyl)azanium chloride (CAS 110675-64-4) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: trimethyl-(2-oxo-2-propan-2-yloxyethyl)azanium chloride. InChIKey: JAPCBMXNZAHKQY-UHFFFAOYSA-M.

Identity
Molecular formulaC8H18ClNO2
Molecular weight195.69 g/mol
IUPAC nametrimethyl-(2-oxo-2-propan-2-yloxyethyl)azanium chloride
InChIKeyJAPCBMXNZAHKQY-UHFFFAOYSA-M
SMILESCC(C)OC(=O)C[N+](C)(C)C.[Cl-]

Computed by PubChem (NCBI)